C24H25N5O6 — CID 171349267
N-[(1-methylindol-3-yl)methyl]-2-(4-nitropyrazol-1-yl)-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 171349267) has the molecular formula C24H25N5O6 and a molecular weight of 479.49 g/mol. Its IUPAC name is N-[(1-methylindol-3-yl)methyl]-2-(4-nitropyrazol-1-yl)-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[(1-methylindol-3-yl)methyl]-2-(4-nitropyrazol-1-yl)-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 171349267 |
| Molecular Formula | C24H25N5O6 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-[(1-methylindol-3-yl)methyl]-2-(4-nitropyrazol-1-yl)-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(N(Cc2cn(C)c3ccccc23)C(=O)Cn2cc([N+](=O)[O-])cn2)cc(OC)c1OC |
| InChI | InChI=1S/C24H25N5O6/c1-26-12-16(19-7-5-6-8-20(19)26)13-28(23(30)15-27-14-18(11-25-27)29(31)32)17-9-21(33-2)24(35-4)22(10-17)34-3/h5-12,14H,13,15H2,1-4H3 |
| InChIKey | MSCDXLDOKUXPCX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 113.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|