C17H17BrN8O5S — CID 171350174
1-[[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)amino]acetyl]amino]-3-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]thiourea (PubChem CID 171350174) has the molecular formula C17H17BrN8O5S and a molecular weight of 525.35 g/mol. Its IUPAC name is 1-[[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)amino]acetyl]amino]-3-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]thiourea.
| Compound Name | 1-[[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)amino]acetyl]amino]-3-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]thiourea |
|---|---|
| PubChem CID | 171350174 |
| Molecular Formula | C17H17BrN8O5S |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | 1-[[2-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)amino]acetyl]amino]-3-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]thiourea |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1NCC(=O)NNC(=S)NCC1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C17H17BrN8O5S/c1-7-21-11-3-2-8(18)4-9(11)15(30)26(7)20-6-12(27)24-25-17(32)19-5-10-13(28)22-16(31)23-14(10)29/h2-4,10,20H,5-6H2,1H3,(H,24,27)(H2,19,25,32)(H2,22,23,28,29,31) |
| InChIKey | UEGBISPMBCRPCI-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 175.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|