C22H28N2O5 — CID 171350531
N-[2-[2-[4-[(3-nitrophenyl)methoxy]phenoxy]ethoxy]ethyl]cyclopentanamine (PubChem CID 171350531) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[2-[2-[4-[(3-nitrophenyl)methoxy]phenoxy]ethoxy]ethyl]cyclopentanamine.
| Compound Name | N-[2-[2-[4-[(3-nitrophenyl)methoxy]phenoxy]ethoxy]ethyl]cyclopentanamine |
|---|---|
| PubChem CID | 171350531 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[2-[2-[4-[(3-nitrophenyl)methoxy]phenoxy]ethoxy]ethyl]cyclopentanamine |
| SMILES | O=[N+]([O-])c1cccc(COc2ccc(OCCOCCNC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C22H28N2O5/c25-24(26)20-7-3-4-18(16-20)17-29-22-10-8-21(9-11-22)28-15-14-27-13-12-23-19-5-1-2-6-19/h3-4,7-11,16,19,23H,1-2,5-6,12-15,17H2 |
| InChIKey | YNHZCMDMKQELHR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|