C21H24N2O3 — CID 68994127
(3S,8aR)-3-[4-[(3-nitrophenyl)methoxy]phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 68994127) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (3S,8aR)-3-[4-[(3-nitrophenyl)methoxy]phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (3S,8aR)-3-[4-[(3-nitrophenyl)methoxy]phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 68994127 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (3S,8aR)-3-[4-[(3-nitrophenyl)methoxy]phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | O=[N+]([O-])c1cccc(COc2ccc([C@@H]3CC[C@H]4CCCCN43)cc2)c1 |
| InChI | InChI=1S/C21H24N2O3/c24-23(25)19-6-3-4-16(14-19)15-26-20-10-7-17(8-11-20)21-12-9-18-5-1-2-13-22(18)21/h3-4,6-8,10-11,14,18,21H,1-2,5,9,12-13,15H2/t18-,21+/m1/s1 |
| InChIKey | UXACCMBLFMZQEE-NQIIRXRSSA-N |
| XLogP | 4.86 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|