C23H30N2O5S2 — CID 10299372
N-[3-[[4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)phenoxy]methyl]phenyl]-N-methylsulfonylmethanesulfonamide (PubChem CID 10299372) has the molecular formula C23H30N2O5S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is N-[3-[[4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)phenoxy]methyl]phenyl]-N-methylsulfonylmethanesulfonamide.
| Compound Name | N-[3-[[4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)phenoxy]methyl]phenyl]-N-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 10299372 |
| Molecular Formula | C23H30N2O5S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[3-[[4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)phenoxy]methyl]phenyl]-N-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(c1cccc(COc2ccc(C3CCC4CCCCN43)cc2)c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H30N2O5S2/c1-31(26,27)25(32(2,28)29)21-8-5-6-18(16-21)17-30-22-12-9-19(10-13-22)23-14-11-20-7-3-4-15-24(20)23/h5-6,8-10,12-13,16,20,23H,3-4,7,11,14-15,17H2,1-2H3 |
| InChIKey | ADLBEXQKNIHUCR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |