C20H24N2S — CID 54384413
3-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]sulfanylaniline (PubChem CID 54384413) has the molecular formula C20H24N2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 3-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]sulfanylaniline.
| Compound Name | 3-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]sulfanylaniline |
|---|---|
| PubChem CID | 54384413 |
| Molecular Formula | C20H24N2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]sulfanylaniline |
| SMILES | Nc1cccc(Sc2ccc([C@H]3CC[C@H]4CCCCN43)cc2)c1 |
| InChI | InChI=1S/C20H24N2S/c21-16-4-3-6-19(14-16)23-18-10-7-15(8-11-18)20-12-9-17-5-1-2-13-22(17)20/h3-4,6-8,10-11,14,17,20H,1-2,5,9,12-13,21H2/t17-,20-/m1/s1 |
| InChIKey | VCFMEIRJMIVQJL-YLJYHZDGSA-N |
| XLogP | 5.11 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|