C23H32N2O — CID 11674747
(3R,8aR)-3-[4-(1-piperidin-3-ylbut-3-yn-2-yloxy)phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 11674747) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is (3R,8aR)-3-[4-(1-piperidin-3-ylbut-3-yn-2-yloxy)phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (3R,8aR)-3-[4-(1-piperidin-3-ylbut-3-yn-2-yloxy)phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 11674747 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | (3R,8aR)-3-[4-(1-piperidin-3-ylbut-3-yn-2-yloxy)phenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C#CC(CC1CCCNC1)Oc1ccc([C@H]2CC[C@H]3CCCCN32)cc1 |
| InChI | InChI=1S/C23H32N2O/c1-2-21(16-18-6-5-14-24-17-18)26-22-11-8-19(9-12-22)23-13-10-20-7-3-4-15-25(20)23/h1,8-9,11-12,18,20-21,23-24H,3-7,10,13-17H2/t18?,20-,21?,23-/m1/s1 |
| InChIKey | UOEZIKJRDSEKBA-ULBNDAFZSA-N |
| XLogP | 4.15 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|