C23H37N3 — CID 11559476
N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-1-methyl-N-propylpiperidin-3-amine (PubChem CID 11559476) has the molecular formula C23H37N3 and a molecular weight of 355.57 g/mol. Its IUPAC name is N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-1-methyl-N-propylpiperidin-3-amine.
| Compound Name | N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-1-methyl-N-propylpiperidin-3-amine |
|---|---|
| PubChem CID | 11559476 |
| Molecular Formula | C23H37N3 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.30 |
| IUPAC Name | N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-1-methyl-N-propylpiperidin-3-amine |
| SMILES | CCCN(c1ccc([C@H]2CC[C@H]3CCCCN32)cc1)C1CCCN(C)C1 |
| InChI | InChI=1S/C23H37N3/c1-3-15-25(22-8-6-16-24(2)18-22)21-11-9-19(10-12-21)23-14-13-20-7-4-5-17-26(20)23/h9-12,20,22-23H,3-8,13-18H2,1-2H3/t20-,22?,23-/m1/s1 |
| InChIKey | VDUJKNPEZPRQEW-WPLVIQRKSA-N |
| XLogP | 4.69 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|