C25H41N3 — CID 87648542
4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)-N-methyl-N-pentylaniline;1-azabicyclo[3.1.0]hexane (PubChem CID 87648542) has the molecular formula C25H41N3 and a molecular weight of 383.62 g/mol. Its IUPAC name is 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)-N-methyl-N-pentylaniline;1-azabicyclo[3.1.0]hexane.
| Compound Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)-N-methyl-N-pentylaniline;1-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 87648542 |
| Molecular Formula | C25H41N3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.33 |
| IUPAC Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)-N-methyl-N-pentylaniline;1-azabicyclo[3.1.0]hexane |
| SMILES | C1CC2CN2C1.CCCCCN(C)c1ccc(C2CCC3CCCCN32)cc1 |
| InChI | InChI=1S/C20H32N2.C5H9N/c1-3-4-6-15-21(2)18-11-9-17(10-12-18)20-14-13-19-8-5-7-16-22(19)20;1-2-5-4-6(5)3-1/h9-12,19-20H,3-8,13-16H2,1-2H3;5H,1-4H2 |
| InChIKey | CPMMPIHGLLSAOW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|