About N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine
N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine (PubChem CID 83823087) has the molecular formula C11H21N5
and a molecular weight of 223.32 g/mol. Its IUPAC name is N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine |
| PubChem CID | 83823087 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine |
| SMILES | CN1CCCC(N(CCN)c2cn[nH]c2)C1 |
| InChI | InChI=1S/C11H21N5/c1-15-5-2-3-10(9-15)16(6-4-12)11-7-13-14-8-11/h7-8,10H,2-6,9,12H2,1H3,(H,13,14) |
| InChIKey | VNQACDKGQAPGPO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine?
The IUPAC name of N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine (CID 83823087) is N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine is CN1CCCC(N(CCN)c2cn[nH]c2)C1.
What is the InChIKey of N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine?
The InChIKey is VNQACDKGQAPGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5/c1-15-5-2-3-10(9-15)16(6-4-12)11-7-13-14-8-11/h7-8,10H,2-6,9,12H2,1H3,(H,13,14).
What are the key properties of N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine?
N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine has a molecular weight of 223.32 g/mol, XLogP of 0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-methylpiperidin-3-yl)-N'-(1H-pyrazol-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 83823087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).