C10H20ClN5O2S — CID 155389382
(3S)-1-methyl-3-[(1-methylpyrazol-4-yl)-sulfamoylamino]piperidine;hydrochloride (PubChem CID 155389382) has the molecular formula C10H20ClN5O2S and a molecular weight of 309.82 g/mol. Its IUPAC name is (3S)-1-methyl-3-[(1-methylpyrazol-4-yl)-sulfamoylamino]piperidine;hydrochloride.
| Compound Name | (3S)-1-methyl-3-[(1-methylpyrazol-4-yl)-sulfamoylamino]piperidine;hydrochloride |
|---|---|
| PubChem CID | 155389382 |
| Molecular Formula | C10H20ClN5O2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (3S)-1-methyl-3-[(1-methylpyrazol-4-yl)-sulfamoylamino]piperidine;hydrochloride |
| SMILES | CN1CCC[C@H](N(c2cnn(C)c2)S(N)(=O)=O)C1.Cl |
| InChI | InChI=1S/C10H19N5O2S.ClH/c1-13-5-3-4-9(7-13)15(18(11,16)17)10-6-12-14(2)8-10;/h6,8-9H,3-5,7H2,1-2H3,(H2,11,16,17);1H/t9-;/m0./s1 |
| InChIKey | LDVHWMSLQPGKNT-FVGYRXGTSA-N |
| XLogP | -0.05 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |