C10H20ClN5O2S — CID 175713036
1-methyl-N'-[(3R)-1-methylpiperidin-3-yl]pyrazole-4-sulfonohydrazide;hydrochloride (PubChem CID 175713036) has the molecular formula C10H20ClN5O2S and a molecular weight of 309.82 g/mol. Its IUPAC name is 1-methyl-N'-[(3R)-1-methylpiperidin-3-yl]pyrazole-4-sulfonohydrazide;hydrochloride.
| Compound Name | 1-methyl-N'-[(3R)-1-methylpiperidin-3-yl]pyrazole-4-sulfonohydrazide;hydrochloride |
|---|---|
| PubChem CID | 175713036 |
| Molecular Formula | C10H20ClN5O2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-methyl-N'-[(3R)-1-methylpiperidin-3-yl]pyrazole-4-sulfonohydrazide;hydrochloride |
| SMILES | CN1CCC[C@@H](NNS(=O)(=O)c2cnn(C)c2)C1.Cl |
| InChI | InChI=1S/C10H19N5O2S.ClH/c1-14-5-3-4-9(7-14)12-13-18(16,17)10-6-11-15(2)8-10;/h6,8-9,12-13H,3-5,7H2,1-2H3;1H/t9-;/m1./s1 |
| InChIKey | CFADHJIDXHFQBG-SBSPUUFOSA-N |
| XLogP | -0.28 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|