C10H20N5O2S+ — CID 167407465
(3R)-1-methyl-3-[(1-methylpyrazol-4-yl)-sulfamoylamino]piperidin-1-ium (PubChem CID 167407465) has the molecular formula C10H20N5O2S+ and a molecular weight of 274.37 g/mol. Its IUPAC name is (3R)-1-methyl-3-[(1-methylpyrazol-4-yl)-sulfamoylamino]piperidin-1-ium.
| Compound Name | (3R)-1-methyl-3-[(1-methylpyrazol-4-yl)-sulfamoylamino]piperidin-1-ium |
|---|---|
| PubChem CID | 167407465 |
| Molecular Formula | C10H20N5O2S+ |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (3R)-1-methyl-3-[(1-methylpyrazol-4-yl)-sulfamoylamino]piperidin-1-ium |
| SMILES | Cn1cc(N([C@@H]2CCC[NH+](C)C2)S(N)(=O)=O)cn1 |
| InChI | InChI=1S/C10H19N5O2S/c1-13-5-3-4-9(7-13)15(18(11,16)17)10-6-12-14(2)8-10/h6,8-9H,3-5,7H2,1-2H3,(H2,11,16,17)/p+1/t9-/m1/s1 |
| InChIKey | KMWXUQWAOSPGIC-SECBINFHSA-O |
| XLogP | -1.89 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |