C10H17N4O2S- — CID 155396534
1-methyl-3-[(1-methylpyrazol-4-yl)-sulfinatoamino]piperidine (PubChem CID 155396534) has the molecular formula C10H17N4O2S- and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-methyl-3-[(1-methylpyrazol-4-yl)-sulfinatoamino]piperidine.
| Compound Name | 1-methyl-3-[(1-methylpyrazol-4-yl)-sulfinatoamino]piperidine |
|---|---|
| PubChem CID | 155396534 |
| Molecular Formula | C10H17N4O2S- |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-methyl-3-[(1-methylpyrazol-4-yl)-sulfinatoamino]piperidine |
| SMILES | CN1CCCC(N(c2cnn(C)c2)S(=O)[O-])C1 |
| InChI | InChI=1S/C10H18N4O2S/c1-12-5-3-4-9(7-12)14(17(15)16)10-6-11-13(2)8-10/h6,8-9H,3-5,7H2,1-2H3,(H,15,16)/p-1 |
| InChIKey | GZQJBFWXGDEJEN-UHFFFAOYSA-M |
| XLogP | 0.11 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|