C17H29N5O2S — CID 155400863
tert-butyl N-[(1-cyclopropylpyrazol-4-yl)-(1-methylpiperidin-3-yl)amino]sulfanylcarbamate (PubChem CID 155400863) has the molecular formula C17H29N5O2S and a molecular weight of 367.52 g/mol. Its IUPAC name is tert-butyl N-[(1-cyclopropylpyrazol-4-yl)-(1-methylpiperidin-3-yl)amino]sulfanylcarbamate.
| Compound Name | tert-butyl N-[(1-cyclopropylpyrazol-4-yl)-(1-methylpiperidin-3-yl)amino]sulfanylcarbamate |
|---|---|
| PubChem CID | 155400863 |
| Molecular Formula | C17H29N5O2S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | tert-butyl N-[(1-cyclopropylpyrazol-4-yl)-(1-methylpiperidin-3-yl)amino]sulfanylcarbamate |
| SMILES | CN1CCCC(N(SNC(=O)OC(C)(C)C)c2cnn(C3CC3)c2)C1 |
| InChI | InChI=1S/C17H29N5O2S/c1-17(2,3)24-16(23)19-25-22(14-6-5-9-20(4)11-14)15-10-18-21(12-15)13-7-8-13/h10,12-14H,5-9,11H2,1-4H3,(H,19,23) |
| InChIKey | CUXJADBGDQIIMS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|