C23H36N6OS2 — CID 155400712
1-[(1-cyclopropylpyrazol-4-yl)-(1-methylpiperidin-3-yl)amino]sulfanyl-3-[2,5-di(propan-2-yl)thiophen-3-yl]urea (PubChem CID 155400712) has the molecular formula C23H36N6OS2 and a molecular weight of 476.72 g/mol. Its IUPAC name is 1-[(1-cyclopropylpyrazol-4-yl)-(1-methylpiperidin-3-yl)amino]sulfanyl-3-[2,5-di(propan-2-yl)thiophen-3-yl]urea.
| Compound Name | 1-[(1-cyclopropylpyrazol-4-yl)-(1-methylpiperidin-3-yl)amino]sulfanyl-3-[2,5-di(propan-2-yl)thiophen-3-yl]urea |
|---|---|
| PubChem CID | 155400712 |
| Molecular Formula | C23H36N6OS2 |
| Molecular Weight | 476.72 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 1-[(1-cyclopropylpyrazol-4-yl)-(1-methylpiperidin-3-yl)amino]sulfanyl-3-[2,5-di(propan-2-yl)thiophen-3-yl]urea |
| SMILES | CC(C)c1cc(NC(=O)NSN(c2cnn(C3CC3)c2)C2CCCN(C)C2)c(C(C)C)s1 |
| InChI | InChI=1S/C23H36N6OS2/c1-15(2)21-11-20(22(31-21)16(3)4)25-23(30)26-32-29(18-7-6-10-27(5)13-18)19-12-24-28(14-19)17-8-9-17/h11-12,14-18H,6-10,13H2,1-5H3,(H2,25,26,30) |
| InChIKey | RJVMMFXYFSKKSE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.72 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|