C20H32N6O2S — CID 155737703
1-(2-ethyl-5-propan-2-ylfuran-3-yl)-3-[(1-methylpiperidin-3-yl)-(1-methylpyrazol-4-yl)amino]sulfanylurea (PubChem CID 155737703) has the molecular formula C20H32N6O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 1-(2-ethyl-5-propan-2-ylfuran-3-yl)-3-[(1-methylpiperidin-3-yl)-(1-methylpyrazol-4-yl)amino]sulfanylurea.
| Compound Name | 1-(2-ethyl-5-propan-2-ylfuran-3-yl)-3-[(1-methylpiperidin-3-yl)-(1-methylpyrazol-4-yl)amino]sulfanylurea |
|---|---|
| PubChem CID | 155737703 |
| Molecular Formula | C20H32N6O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-(2-ethyl-5-propan-2-ylfuran-3-yl)-3-[(1-methylpiperidin-3-yl)-(1-methylpyrazol-4-yl)amino]sulfanylurea |
| SMILES | CCc1oc(C(C)C)cc1NC(=O)NSN(c1cnn(C)c1)C1CCCN(C)C1 |
| InChI | InChI=1S/C20H32N6O2S/c1-6-18-17(10-19(28-18)14(2)3)22-20(27)23-29-26(16-11-21-25(5)13-16)15-8-7-9-24(4)12-15/h10-11,13-15H,6-9,12H2,1-5H3,(H2,22,23,27) |
| InChIKey | GYAOKJDUQPSRNU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|