C18H27ClN6OS2 — CID 155737639
1-(5-chloro-2-propan-2-ylthiophen-3-yl)-3-[(1-methylpiperidin-3-yl)-(1-methylpyrazol-4-yl)amino]sulfanylurea (PubChem CID 155737639) has the molecular formula C18H27ClN6OS2 and a molecular weight of 443.04 g/mol. Its IUPAC name is 1-(5-chloro-2-propan-2-ylthiophen-3-yl)-3-[(1-methylpiperidin-3-yl)-(1-methylpyrazol-4-yl)amino]sulfanylurea.
| Compound Name | 1-(5-chloro-2-propan-2-ylthiophen-3-yl)-3-[(1-methylpiperidin-3-yl)-(1-methylpyrazol-4-yl)amino]sulfanylurea |
|---|---|
| PubChem CID | 155737639 |
| Molecular Formula | C18H27ClN6OS2 |
| Molecular Weight | 443.04 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-(5-chloro-2-propan-2-ylthiophen-3-yl)-3-[(1-methylpiperidin-3-yl)-(1-methylpyrazol-4-yl)amino]sulfanylurea |
| SMILES | CC(C)c1sc(Cl)cc1NC(=O)NSN(c1cnn(C)c1)C1CCCN(C)C1 |
| InChI | InChI=1S/C18H27ClN6OS2/c1-12(2)17-15(8-16(19)27-17)21-18(26)22-28-25(14-9-20-24(4)11-14)13-6-5-7-23(3)10-13/h8-9,11-13H,5-7,10H2,1-4H3,(H2,21,22,26) |
| InChIKey | PWUMKMBWCYZBNZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.04 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|