C15H27FN5O2S+ — CID 155737570
tert-butyl N-[[(2S)-4-fluoro-1,1-dimethylazetidin-1-ium-2-yl]methyl-(1-methylpyrazol-4-yl)amino]sulfanylcarbamate (PubChem CID 155737570) has the molecular formula C15H27FN5O2S+ and a molecular weight of 360.48 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-4-fluoro-1,1-dimethylazetidin-1-ium-2-yl]methyl-(1-methylpyrazol-4-yl)amino]sulfanylcarbamate.
| Compound Name | tert-butyl N-[[(2S)-4-fluoro-1,1-dimethylazetidin-1-ium-2-yl]methyl-(1-methylpyrazol-4-yl)amino]sulfanylcarbamate |
|---|---|
| PubChem CID | 155737570 |
| Molecular Formula | C15H27FN5O2S+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | tert-butyl N-[[(2S)-4-fluoro-1,1-dimethylazetidin-1-ium-2-yl]methyl-(1-methylpyrazol-4-yl)amino]sulfanylcarbamate |
| SMILES | Cn1cc(N(C[C@@H]2CC(F)[N+]2(C)C)SNC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C15H26FN5O2S/c1-15(2,3)23-14(22)18-24-20(11-8-17-19(4)9-11)10-12-7-13(16)21(12,5)6/h8-9,12-13H,7,10H2,1-6H3/p+1/t12-,13?/m0/s1 |
| InChIKey | CJMMXMQUOJRAOA-UEWDXFNNSA-O |
| XLogP | 2.46 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|