C14H24N4O5S — CID 162749581
tert-butyl N-[(1-methylpyrazol-4-yl)-[[(2R)-oxolan-2-yl]methyl]sulfamoyl]carbamate (PubChem CID 162749581) has the molecular formula C14H24N4O5S and a molecular weight of 360.44 g/mol. Its IUPAC name is tert-butyl N-[(1-methylpyrazol-4-yl)-[[(2R)-oxolan-2-yl]methyl]sulfamoyl]carbamate.
| Compound Name | tert-butyl N-[(1-methylpyrazol-4-yl)-[[(2R)-oxolan-2-yl]methyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 162749581 |
| Molecular Formula | C14H24N4O5S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | tert-butyl N-[(1-methylpyrazol-4-yl)-[[(2R)-oxolan-2-yl]methyl]sulfamoyl]carbamate |
| SMILES | Cn1cc(N(C[C@H]2CCCO2)S(=O)(=O)NC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C14H24N4O5S/c1-14(2,3)23-13(19)16-24(20,21)18(10-12-6-5-7-22-12)11-8-15-17(4)9-11/h8-9,12H,5-7,10H2,1-4H3,(H,16,19)/t12-/m1/s1 |
| InChIKey | PVOHADOZQFYELS-GFCCVEGCSA-N |
| XLogP | 1.17 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |