C21H26N5O4S- — CID 170689304
N'-[(1-methylpyrazol-4-yl)-[[(2R)-oxan-2-yl]methyl]sulfamoyl]-N-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)carbamimidate (PubChem CID 170689304) has the molecular formula C21H26N5O4S- and a molecular weight of 444.54 g/mol. Its IUPAC name is N'-[(1-methylpyrazol-4-yl)-[[(2R)-oxan-2-yl]methyl]sulfamoyl]-N-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)carbamimidate.
| Compound Name | N'-[(1-methylpyrazol-4-yl)-[[(2R)-oxan-2-yl]methyl]sulfamoyl]-N-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)carbamimidate |
|---|---|
| PubChem CID | 170689304 |
| Molecular Formula | C21H26N5O4S- |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N'-[(1-methylpyrazol-4-yl)-[[(2R)-oxan-2-yl]methyl]sulfamoyl]-N-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)carbamimidate |
| SMILES | Cn1cc(N(C[C@H]2CCCCO2)S(=O)(=O)/N=C(\[O-])Nc2c3c(cc4c2CC4)CC3)cn1 |
| InChI | InChI=1S/C21H27N5O4S/c1-25-12-16(11-22-25)26(13-17-4-2-3-9-30-17)31(28,29)24-21(27)23-20-18-7-5-14(18)10-15-6-8-19(15)20/h10-12,17H,2-9,13H2,1H3,(H2,23,24,27)/p-1/t17-/m1/s1 |
| InChIKey | MYWFINOPHWCNQZ-QGZVFWFLSA-M |
| XLogP | 1.07 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|