C23H33N6O3S- — CID 164823146
N'-[2-(dimethylamino)ethyl-(1-propan-2-ylpyrazol-4-yl)sulfamoyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamimidate (PubChem CID 164823146) has the molecular formula C23H33N6O3S- and a molecular weight of 473.62 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl-(1-propan-2-ylpyrazol-4-yl)sulfamoyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamimidate.
| Compound Name | N'-[2-(dimethylamino)ethyl-(1-propan-2-ylpyrazol-4-yl)sulfamoyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamimidate |
|---|---|
| PubChem CID | 164823146 |
| Molecular Formula | C23H33N6O3S- |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl-(1-propan-2-ylpyrazol-4-yl)sulfamoyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamimidate |
| SMILES | CC(C)n1cc(N(CCN(C)C)S(=O)(=O)/N=C(\[O-])Nc2c3c(cc4c2CCC4)CCC3)cn1 |
| InChI | InChI=1S/C23H34N6O3S/c1-16(2)28-15-19(14-24-28)29(12-11-27(3)4)33(31,32)26-23(30)25-22-20-9-5-7-17(20)13-18-8-6-10-21(18)22/h13-16H,5-12H2,1-4H3,(H2,25,26,30)/p-1 |
| InChIKey | JUZJZXKGHBJHBF-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|