C24H32N5O5S- — CID 155760615
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-N'-[[1-(2-methoxyethyl)pyrazol-4-yl]-(oxan-4-yl)sulfamoyl]carbamimidate (PubChem CID 155760615) has the molecular formula C24H32N5O5S- and a molecular weight of 502.62 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-N'-[[1-(2-methoxyethyl)pyrazol-4-yl]-(oxan-4-yl)sulfamoyl]carbamimidate.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-N'-[[1-(2-methoxyethyl)pyrazol-4-yl]-(oxan-4-yl)sulfamoyl]carbamimidate |
|---|---|
| PubChem CID | 155760615 |
| Molecular Formula | C24H32N5O5S- |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-N'-[[1-(2-methoxyethyl)pyrazol-4-yl]-(oxan-4-yl)sulfamoyl]carbamimidate |
| SMILES | COCCn1cc(N(C2CCOCC2)S(=O)(=O)/N=C(\[O-])Nc2c3c(cc4c2CCC4)CCC3)cn1 |
| InChI | InChI=1S/C24H33N5O5S/c1-33-13-10-28-16-20(15-25-28)29(19-8-11-34-12-9-19)35(31,32)27-24(30)26-23-21-6-2-4-17(21)14-18-5-3-7-22(18)23/h14-16,19H,2-13H2,1H3,(H2,26,27,30)/p-1 |
| InChIKey | UDSVVALNVOSBNM-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|