C24H31N4O5S- — CID 155760729
N'-[(3-ethyl-4-methyl-1,2-oxazol-5-yl)-(oxan-4-yl)sulfamoyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamimidate (PubChem CID 155760729) has the molecular formula C24H31N4O5S- and a molecular weight of 487.60 g/mol. Its IUPAC name is N'-[(3-ethyl-4-methyl-1,2-oxazol-5-yl)-(oxan-4-yl)sulfamoyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamimidate.
| Compound Name | N'-[(3-ethyl-4-methyl-1,2-oxazol-5-yl)-(oxan-4-yl)sulfamoyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamimidate |
|---|---|
| PubChem CID | 155760729 |
| Molecular Formula | C24H31N4O5S- |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N'-[(3-ethyl-4-methyl-1,2-oxazol-5-yl)-(oxan-4-yl)sulfamoyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamimidate |
| SMILES | CCc1noc(N(C2CCOCC2)S(=O)(=O)/N=C(\[O-])Nc2c3c(cc4c2CCC4)CCC3)c1C |
| InChI | InChI=1S/C24H32N4O5S/c1-3-21-15(2)23(33-26-21)28(18-10-12-32-13-11-18)34(30,31)27-24(29)25-22-19-8-4-6-16(19)14-17-7-5-9-20(17)22/h14,18H,3-13H2,1-2H3,(H2,25,27,29)/p-1 |
| InChIKey | PFSKHEITEIJSTR-UHFFFAOYSA-M |
| XLogP | 2.58 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|