C22H27N4O5S- — CID 155760704
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-N'-[(2-methyl-1,3-oxazol-4-yl)-(oxan-4-yl)sulfamoyl]carbamimidate (PubChem CID 155760704) has the molecular formula C22H27N4O5S- and a molecular weight of 459.55 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-N'-[(2-methyl-1,3-oxazol-4-yl)-(oxan-4-yl)sulfamoyl]carbamimidate.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-N'-[(2-methyl-1,3-oxazol-4-yl)-(oxan-4-yl)sulfamoyl]carbamimidate |
|---|---|
| PubChem CID | 155760704 |
| Molecular Formula | C22H27N4O5S- |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-N'-[(2-methyl-1,3-oxazol-4-yl)-(oxan-4-yl)sulfamoyl]carbamimidate |
| SMILES | Cc1nc(N(C2CCOCC2)S(=O)(=O)/N=C(\[O-])Nc2c3c(cc4c2CCC4)CCC3)co1 |
| InChI | InChI=1S/C22H28N4O5S/c1-14-23-20(13-31-14)26(17-8-10-30-11-9-17)32(28,29)25-22(27)24-21-18-6-2-4-15(18)12-16-5-3-7-19(16)21/h12-13,17H,2-11H2,1H3,(H2,24,25,27)/p-1 |
| InChIKey | MXZROWCNPJBDNI-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|