C9H16N4O3S — CID 155389004
1-methyl-4-[(oxolan-2-ylmethylamino)-sulfinoamino]pyrazole (PubChem CID 155389004) has the molecular formula C9H16N4O3S and a molecular weight of 260.32 g/mol. Its IUPAC name is 1-methyl-4-[(oxolan-2-ylmethylamino)-sulfinoamino]pyrazole.
| Compound Name | 1-methyl-4-[(oxolan-2-ylmethylamino)-sulfinoamino]pyrazole |
|---|---|
| PubChem CID | 155389004 |
| Molecular Formula | C9H16N4O3S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-methyl-4-[(oxolan-2-ylmethylamino)-sulfinoamino]pyrazole |
| SMILES | Cn1cc(N(NCC2CCCO2)S(=O)O)cn1 |
| InChI | InChI=1S/C9H16N4O3S/c1-12-7-8(5-10-12)13(17(14)15)11-6-9-3-2-4-16-9/h5,7,9,11H,2-4,6H2,1H3,(H,14,15) |
| InChIKey | YITRUDUCDMBNFV-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|