C10H19N5O2S — CID 155389600
1-methyl-4-[2-(1-methylpyrazol-4-yl)-2-sulfinohydrazinyl]piperidine (PubChem CID 155389600) has the molecular formula C10H19N5O2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-methyl-4-[2-(1-methylpyrazol-4-yl)-2-sulfinohydrazinyl]piperidine.
| Compound Name | 1-methyl-4-[2-(1-methylpyrazol-4-yl)-2-sulfinohydrazinyl]piperidine |
|---|---|
| PubChem CID | 155389600 |
| Molecular Formula | C10H19N5O2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-methyl-4-[2-(1-methylpyrazol-4-yl)-2-sulfinohydrazinyl]piperidine |
| SMILES | CN1CCC(NN(c2cnn(C)c2)S(=O)O)CC1 |
| InChI | InChI=1S/C10H19N5O2S/c1-13-5-3-9(4-6-13)12-15(18(16)17)10-7-11-14(2)8-10/h7-9,12H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | YWBCYKWBVQIXGD-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|