About CID 68747406
CID 68747406 (PubChem CID 68747406) has the molecular formula C4H6N2NaO2S
and a molecular weight of 169.16 g/mol.
Molecular Properties
| Compound Name | CID 68747406 |
| PubChem CID | 68747406 |
| Molecular Formula | C4H6N2NaO2S |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | — |
| SMILES | Cn1cc(S(=O)O)cn1.[Na] |
| InChI | InChI=1S/C4H6N2O2S.Na/c1-6-3-4(2-5-6)9(7)8;/h2-3H,1H3,(H,7,8); |
| InChIKey | HSMWEDJKXKZGLW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 68747406 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68747406?
The IUPAC name of CID 68747406 (CID 68747406) is not available.
What is the SMILES notation for CID 68747406?
The canonical SMILES for CID 68747406 is Cn1cc(S(=O)O)cn1.[Na].
What is the InChIKey of CID 68747406?
The InChIKey is HSMWEDJKXKZGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2S.Na/c1-6-3-4(2-5-6)9(7)8;/h2-3H,1H3,(H,7,8);.
What are the key properties of CID 68747406?
CID 68747406 has a molecular weight of 169.16 g/mol, XLogP of -0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68747406 is sourced from PubChem (CID 68747406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).