C10H9N5O2S — CID 71197167
3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazine-8-sulfinic acid (PubChem CID 71197167) has the molecular formula C10H9N5O2S and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazine-8-sulfinic acid.
| Compound Name | 3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazine-8-sulfinic acid |
|---|---|
| PubChem CID | 71197167 |
| Molecular Formula | C10H9N5O2S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazine-8-sulfinic acid |
| SMILES | Cn1cc(-c2cnc3c(S(=O)O)nccn23)cn1 |
| InChI | InChI=1S/C10H9N5O2S/c1-14-6-7(4-13-14)8-5-12-9-10(18(16)17)11-2-3-15(8)9/h2-6H,1H3,(H,16,17) |
| InChIKey | CFICTQHHBDJLGZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|