C13H14N8S — CID 89358391
(methylideneamino) N'-methyl-N-[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]carbamimidothioate (PubChem CID 89358391) has the molecular formula C13H14N8S and a molecular weight of 314.38 g/mol. Its IUPAC name is (methylideneamino) N'-methyl-N-[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]carbamimidothioate.
| Compound Name | (methylideneamino) N'-methyl-N-[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]carbamimidothioate |
|---|---|
| PubChem CID | 89358391 |
| Molecular Formula | C13H14N8S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (methylideneamino) N'-methyl-N-[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]carbamimidothioate |
| SMILES | C=NS/C(=N\C)Nc1nccn2c(-c3cnn(C)c3)cnc12 |
| InChI | InChI=1S/C13H14N8S/c1-14-13(22-15-2)19-11-12-17-7-10(21(12)5-4-16-11)9-6-18-20(3)8-9/h4-8H,2H2,1,3H3,(H,14,16,19) |
| InChIKey | WOOBZHBDPRVTSL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|