C15H14N6O2S2 — CID 71196606
3-methyl-5-[[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-sulfinic acid (PubChem CID 71196606) has the molecular formula C15H14N6O2S2 and a molecular weight of 374.45 g/mol. Its IUPAC name is 3-methyl-5-[[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-sulfinic acid.
| Compound Name | 3-methyl-5-[[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-sulfinic acid |
|---|---|
| PubChem CID | 71196606 |
| Molecular Formula | C15H14N6O2S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 3-methyl-5-[[3-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]amino]thiophene-2-sulfinic acid |
| SMILES | Cc1cc(Nc2nccn3c(-c4cnn(C)c4)cnc23)sc1S(=O)O |
| InChI | InChI=1S/C15H14N6O2S2/c1-9-5-12(24-15(9)25(22)23)19-13-14-17-7-11(21(14)4-3-16-13)10-6-18-20(2)8-10/h3-8H,1-2H3,(H,16,19)(H,22,23) |
| InChIKey | QGHQODCUKQEYEF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|