C25H21BFNO6S — CID 171350868
[4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]phenyl]boronic acid (PubChem CID 171350868) has the molecular formula C25H21BFNO6S and a molecular weight of 493.32 g/mol. Its IUPAC name is [4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]phenyl]boronic acid.
| Compound Name | [4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 171350868 |
| Molecular Formula | C25H21BFNO6S |
| Molecular Weight | 493.32 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]phenyl]boronic acid |
| SMILES | COc1cc(/C=C2\SC(=O)N(Cc3ccc(F)cc3)C2=O)ccc1OCc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C25H21BFNO6S/c1-33-22-12-18(6-11-21(22)34-15-17-2-7-19(8-3-17)26(31)32)13-23-24(29)28(25(30)35-23)14-16-4-9-20(27)10-5-16/h2-13,31-32H,14-15H2,1H3/b23-13- |
| InChIKey | ZRDLANLCYCSUJP-QRVIBDJDSA-N |
| XLogP | 3.33 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|