C25H23ClN6 — CID 171352071
5-[(3-chlorophenyl)methyl]-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-phenyl-1,2,4-triazin-6-amine (PubChem CID 171352071) has the molecular formula C25H23ClN6 and a molecular weight of 442.95 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-phenyl-1,2,4-triazin-6-amine.
| Compound Name | 5-[(3-chlorophenyl)methyl]-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-phenyl-1,2,4-triazin-6-amine |
|---|---|
| PubChem CID | 171352071 |
| Molecular Formula | C25H23ClN6 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-phenyl-1,2,4-triazin-6-amine |
| SMILES | CN(C)c1ccc(/C=N/Nc2nnc(-c3ccccc3)nc2Cc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C25H23ClN6/c1-32(2)22-13-11-18(12-14-22)17-27-29-25-23(16-19-7-6-10-21(26)15-19)28-24(30-31-25)20-8-4-3-5-9-20/h3-15,17H,16H2,1-2H3,(H,29,31)/b27-17+ |
| InChIKey | UIXFYWXSOZNUAI-WPWMEQJKSA-N |
| XLogP | 5.29 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|