C14H17F4N5O4 — CID 171352746
2-[[amino-(methylcarbamoylamino)methylidene]amino]-N-(4-fluoro-2-methylphenyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 171352746) has the molecular formula C14H17F4N5O4 and a molecular weight of 395.31 g/mol. Its IUPAC name is 2-[[amino-(methylcarbamoylamino)methylidene]amino]-N-(4-fluoro-2-methylphenyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[amino-(methylcarbamoylamino)methylidene]amino]-N-(4-fluoro-2-methylphenyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171352746 |
| Molecular Formula | C14H17F4N5O4 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-[[amino-(methylcarbamoylamino)methylidene]amino]-N-(4-fluoro-2-methylphenyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)N/C(N)=N/CC(=O)Nc1ccc(F)cc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H16FN5O2.C2HF3O2/c1-7-5-8(13)3-4-9(7)17-10(19)6-16-11(14)18-12(20)15-2;3-2(4,5)1(6)7/h3-5H,6H2,1-2H3,(H,17,19)(H4,14,15,16,18,20);(H,6,7) |
| InChIKey | GDGUMHJXHDKPSX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|