C14H16F3N5O6 — CID 171351235
3-[[2-[[amino-(methylcarbamoylamino)methylidene]amino]acetyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 171351235) has the molecular formula C14H16F3N5O6 and a molecular weight of 407.31 g/mol. Its IUPAC name is 3-[[2-[[amino-(methylcarbamoylamino)methylidene]amino]acetyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[2-[[amino-(methylcarbamoylamino)methylidene]amino]acetyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171351235 |
| Molecular Formula | C14H16F3N5O6 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 3-[[2-[[amino-(methylcarbamoylamino)methylidene]amino]acetyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)N/C(N)=N/CC(=O)Nc1cccc(C(=O)O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H15N5O4.C2HF3O2/c1-14-12(21)17-11(13)15-6-9(18)16-8-4-2-3-7(5-8)10(19)20;3-2(4,5)1(6)7/h2-5H,6H2,1H3,(H,16,18)(H,19,20)(H4,13,14,15,17,21);(H,6,7) |
| InChIKey | RWGBJIFEYPWQFY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|