C13H15F3N6O6 — CID 171358598
2-[[amino-(methylcarbamoylamino)methylidene]amino]-N-(4-nitrophenyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 171358598) has the molecular formula C13H15F3N6O6 and a molecular weight of 408.29 g/mol. Its IUPAC name is 2-[[amino-(methylcarbamoylamino)methylidene]amino]-N-(4-nitrophenyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[amino-(methylcarbamoylamino)methylidene]amino]-N-(4-nitrophenyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171358598 |
| Molecular Formula | C13H15F3N6O6 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-[[amino-(methylcarbamoylamino)methylidene]amino]-N-(4-nitrophenyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)N/C(N)=N/CC(=O)Nc1ccc([N+](=O)[O-])cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H14N6O4.C2HF3O2/c1-13-11(19)16-10(12)14-6-9(18)15-7-2-4-8(5-3-7)17(20)21;3-2(4,5)1(6)7/h2-5H,6H2,1H3,(H,15,18)(H4,12,13,14,16,19);(H,6,7) |
| InChIKey | HXHCJHYPNJWBOI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 189.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|