C21H25NO5 — CID 171353313
6-(2-hydroxy-3-pyrrolidin-1-ylpropoxy)-8,8-dimethylpyrano[2,3-f]chromen-2-one (PubChem CID 171353313) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 6-(2-hydroxy-3-pyrrolidin-1-ylpropoxy)-8,8-dimethylpyrano[2,3-f]chromen-2-one.
| Compound Name | 6-(2-hydroxy-3-pyrrolidin-1-ylpropoxy)-8,8-dimethylpyrano[2,3-f]chromen-2-one |
|---|---|
| PubChem CID | 171353313 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 6-(2-hydroxy-3-pyrrolidin-1-ylpropoxy)-8,8-dimethylpyrano[2,3-f]chromen-2-one |
| SMILES | CC1(C)C=Cc2c(c(OCC(O)CN3CCCC3)cc3ccc(=O)oc23)O1 |
| InChI | InChI=1S/C21H25NO5/c1-21(2)8-7-16-19-14(5-6-18(24)26-19)11-17(20(16)27-21)25-13-15(23)12-22-9-3-4-10-22/h5-8,11,15,23H,3-4,9-10,12-13H2,1-2H3 |
| InChIKey | WFDXZCYIABQSSS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|