C15H14O6 — CID 162925476
4-[(2R)-2-hydroxy-3-methylbut-3-enoxy]-[1,3]dioxolo[4,5-h]chromen-8-one (PubChem CID 162925476) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-[(2R)-2-hydroxy-3-methylbut-3-enoxy]-[1,3]dioxolo[4,5-h]chromen-8-one.
| Compound Name | 4-[(2R)-2-hydroxy-3-methylbut-3-enoxy]-[1,3]dioxolo[4,5-h]chromen-8-one |
|---|---|
| PubChem CID | 162925476 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-[(2R)-2-hydroxy-3-methylbut-3-enoxy]-[1,3]dioxolo[4,5-h]chromen-8-one |
| SMILES | C=C(C)[C@@H](O)COc1cc2ccc(=O)oc2c2c1OCO2 |
| InChI | InChI=1S/C15H14O6/c1-8(2)10(16)6-18-11-5-9-3-4-12(17)21-13(9)15-14(11)19-7-20-15/h3-5,10,16H,1,6-7H2,2H3/t10-/m0/s1 |
| InChIKey | VWFRVIMLJHMPTJ-JTQLQIEISA-N |
| XLogP | 1.84 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|