C25H21N3O6 — CID 171353779
4-[5-(3,4-dimethoxyphenyl)-2-(3,4,5-trihydroxybenzoyl)-3,4-dihydropyrazol-3-yl]benzonitrile (PubChem CID 171353779) has the molecular formula C25H21N3O6 and a molecular weight of 459.46 g/mol. Its IUPAC name is 4-[5-(3,4-dimethoxyphenyl)-2-(3,4,5-trihydroxybenzoyl)-3,4-dihydropyrazol-3-yl]benzonitrile.
| Compound Name | 4-[5-(3,4-dimethoxyphenyl)-2-(3,4,5-trihydroxybenzoyl)-3,4-dihydropyrazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 171353779 |
| Molecular Formula | C25H21N3O6 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 4-[5-(3,4-dimethoxyphenyl)-2-(3,4,5-trihydroxybenzoyl)-3,4-dihydropyrazol-3-yl]benzonitrile |
| SMILES | COc1ccc(C2=NN(C(=O)c3cc(O)c(O)c(O)c3)C(c3ccc(C#N)cc3)C2)cc1OC |
| InChI | InChI=1S/C25H21N3O6/c1-33-22-8-7-16(11-23(22)34-2)18-12-19(15-5-3-14(13-26)4-6-15)28(27-18)25(32)17-9-20(29)24(31)21(30)10-17/h3-11,19,29-31H,12H2,1-2H3 |
| InChIKey | VUSCRSJHJWHNGU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|