C36H38N4O2 — CID 171354419
(2S,3R,4R,5S)-2,5-bis(benzylamino)-1,6-bis(1H-indol-3-yl)hexane-3,4-diol (PubChem CID 171354419) has the molecular formula C36H38N4O2 and a molecular weight of 558.73 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2,5-bis(benzylamino)-1,6-bis(1H-indol-3-yl)hexane-3,4-diol.
| Compound Name | (2S,3R,4R,5S)-2,5-bis(benzylamino)-1,6-bis(1H-indol-3-yl)hexane-3,4-diol |
|---|---|
| PubChem CID | 171354419 |
| Molecular Formula | C36H38N4O2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | (2S,3R,4R,5S)-2,5-bis(benzylamino)-1,6-bis(1H-indol-3-yl)hexane-3,4-diol |
| SMILES | O[C@@H]([C@H](O)[C@H](Cc1c[nH]c2ccccc12)NCc1ccccc1)[C@H](Cc1c[nH]c2ccccc12)NCc1ccccc1 |
| InChI | InChI=1S/C36H38N4O2/c41-35(33(37-21-25-11-3-1-4-12-25)19-27-23-39-31-17-9-7-15-29(27)31)36(42)34(38-22-26-13-5-2-6-14-26)20-28-24-40-32-18-10-8-16-30(28)32/h1-18,23-24,33-42H,19-22H2/t33-,34-,35+,36+/m0/s1 |
| InChIKey | BZAHPTZPXFVQDG-CLLHQPRTSA-N |
| XLogP | 5.47 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |