C26H31N3O7 — CID 171355626
4-methoxy-N-[[(1S,3R,4S,7S,9R)-9-[[(4-methoxybenzoyl)amino]methyl]-3,9-dimethyl-2,5,8-trioxa-10-azatricyclo[5.2.1.04,10]decan-3-yl]methyl]benzamide (PubChem CID 171355626) has the molecular formula C26H31N3O7 and a molecular weight of 497.55 g/mol. Its IUPAC name is 4-methoxy-N-[[(1S,3R,4S,7S,9R)-9-[[(4-methoxybenzoyl)amino]methyl]-3,9-dimethyl-2,5,8-trioxa-10-azatricyclo[5.2.1.04,10]decan-3-yl]methyl]benzamide.
| Compound Name | 4-methoxy-N-[[(1S,3R,4S,7S,9R)-9-[[(4-methoxybenzoyl)amino]methyl]-3,9-dimethyl-2,5,8-trioxa-10-azatricyclo[5.2.1.04,10]decan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 171355626 |
| Molecular Formula | C26H31N3O7 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 4-methoxy-N-[[(1S,3R,4S,7S,9R)-9-[[(4-methoxybenzoyl)amino]methyl]-3,9-dimethyl-2,5,8-trioxa-10-azatricyclo[5.2.1.04,10]decan-3-yl]methyl]benzamide |
| SMILES | COc1ccc(C(=O)NC[C@@]2(C)O[C@H]3CO[C@@H]4N3[C@H]2O[C@]4(C)CNC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H31N3O7/c1-25(14-27-21(30)16-5-9-18(32-3)10-6-16)23-29-20(13-34-23)35-26(2,24(29)36-25)15-28-22(31)17-7-11-19(33-4)12-8-17/h5-12,20,23-24H,13-15H2,1-4H3,(H,27,30)(H,28,31)/t20-,23-,24-,25+,26+/m0/s1 |
| InChIKey | HAIJHRCJDSSKFS-OZJWZVNMSA-N |
| XLogP | 1.75 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |