C20H28N2O3 — CID 124626976
4-methoxy-N-[2-[[(1R,5R,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl]amino]ethyl]benzamide (PubChem CID 124626976) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[(1R,5R,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl]amino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[[(1R,5R,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 124626976 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 4-methoxy-N-[2-[[(1R,5R,6R)-spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-yl]amino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCN[C@@H]2[C@H]3CCO[C@H]3C23CCCC3)cc1 |
| InChI | InChI=1S/C20H28N2O3/c1-24-15-6-4-14(5-7-15)19(23)22-12-11-21-17-16-8-13-25-18(16)20(17)9-2-3-10-20/h4-7,16-18,21H,2-3,8-13H2,1H3,(H,22,23)/t16-,17-,18-/m1/s1 |
| InChIKey | HXPFNPNGYZIXAM-KZNAEPCWSA-N |
| XLogP | 2.36 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|