C10H15NO3 — CID 171356582
tert-butyl (2S)-4-methylidene-5-oxopyrrolidine-2-carboxylate (PubChem CID 171356582) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is tert-butyl (2S)-4-methylidene-5-oxopyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-4-methylidene-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 171356582 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | tert-butyl (2S)-4-methylidene-5-oxopyrrolidine-2-carboxylate |
| SMILES | C=C1C[C@@H](C(=O)OC(C)(C)C)NC1=O |
| InChI | InChI=1S/C10H15NO3/c1-6-5-7(11-8(6)12)9(13)14-10(2,3)4/h7H,1,5H2,2-4H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | SPQUROAYSANKIQ-ZETCQYMHSA-N |
| XLogP | 0.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|