About ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate
ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 11254971) has the molecular formula C15H23NO5
and a molecular weight of 297.35 g/mol. Its IUPAC name is ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate |
| PubChem CID | 11254971 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | C=C1C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C15H23NO5/c1-9-8-10(12(18)20-14(2,3)4)16(11(9)17)13(19)21-15(5,6)7/h10H,1,8H2,2-7H3/t10-/m0/s1 |
| InChIKey | JWWRGCRTSGYSDU-JTQLQIEISA-N |
| XLogP | 2.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate?
The IUPAC name of ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate (CID 11254971) is ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate?
The canonical SMILES for ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate is C=C1C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1=O.
What is the InChIKey of ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate?
The InChIKey is JWWRGCRTSGYSDU-JTQLQIEISA-N. The full InChI is InChI=1S/C15H23NO5/c1-9-8-10(12(18)20-14(2,3)4)16(11(9)17)13(19)21-15(5,6)7/h10H,1,8H2,2-7H3/t10-/m0/s1.
What are the key properties of ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate?
ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate has a molecular weight of 297.35 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2S)-4-methylidene-5-oxopyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 11254971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).