C27H29ClN4O3 — CID 171357178
2-[6-[(7-chloroquinolin-4-yl)amino]hexyl]-5-morpholin-4-ylisoindole-1,3-dione (PubChem CID 171357178) has the molecular formula C27H29ClN4O3 and a molecular weight of 493.01 g/mol. Its IUPAC name is 2-[6-[(7-chloroquinolin-4-yl)amino]hexyl]-5-morpholin-4-ylisoindole-1,3-dione.
| Compound Name | 2-[6-[(7-chloroquinolin-4-yl)amino]hexyl]-5-morpholin-4-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 171357178 |
| Molecular Formula | C27H29ClN4O3 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 2-[6-[(7-chloroquinolin-4-yl)amino]hexyl]-5-morpholin-4-ylisoindole-1,3-dione |
| SMILES | O=C1c2ccc(N3CCOCC3)cc2C(=O)N1CCCCCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C27H29ClN4O3/c28-19-5-7-22-24(9-11-30-25(22)17-19)29-10-3-1-2-4-12-32-26(33)21-8-6-20(18-23(21)27(32)34)31-13-15-35-16-14-31/h5-9,11,17-18H,1-4,10,12-16H2,(H,29,30) |
| InChIKey | DIAFYNAJIHVAEB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|