C21H30N2O4 — CID 171358000
1-benzyl-N-[[(1S)-cyclohex-3-en-1-yl]methyl]piperidin-4-amine;oxalic acid (PubChem CID 171358000) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 1-benzyl-N-[[(1S)-cyclohex-3-en-1-yl]methyl]piperidin-4-amine;oxalic acid.
| Compound Name | 1-benzyl-N-[[(1S)-cyclohex-3-en-1-yl]methyl]piperidin-4-amine;oxalic acid |
|---|---|
| PubChem CID | 171358000 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-benzyl-N-[[(1S)-cyclohex-3-en-1-yl]methyl]piperidin-4-amine;oxalic acid |
| SMILES | C1=CC[C@@H](CNC2CCN(Cc3ccccc3)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H28N2.C2H2O4/c1-3-7-17(8-4-1)15-20-19-11-13-21(14-12-19)16-18-9-5-2-6-10-18;3-1(4)2(5)6/h1-3,5-6,9-10,17,19-20H,4,7-8,11-16H2;(H,3,4)(H,5,6)/t17-;/m1./s1 |
| InChIKey | FKLVXNSFVAHIQF-UNTBIKODSA-N |
| XLogP | 2.75 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|