C26H21FN2O5S — CID 171358424
[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 171358424) has the molecular formula C26H21FN2O5S and a molecular weight of 492.53 g/mol. Its IUPAC name is [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
| Compound Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 171358424 |
| Molecular Formula | C26H21FN2O5S |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | COc1cc(/C=C/c2ccc(OC(=O)CSc3nnc(-c4ccc(F)cc4)o3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C26H21FN2O5S/c1-31-22-13-18(14-23(15-22)32-2)4-3-17-5-11-21(12-6-17)33-24(30)16-35-26-29-28-25(34-26)19-7-9-20(27)10-8-19/h3-15H,16H2,1-2H3/b4-3+ |
| InChIKey | YNLCNONDBZSXKN-ONEGZZNKSA-N |
| XLogP | 5.76 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|