C21H28ClN3O — CID 171359941
N-[[(3R)-1-(3-chlorophenyl)pyrrolidin-3-yl]methyl]-1-(furan-2-ylmethyl)piperidin-4-amine (PubChem CID 171359941) has the molecular formula C21H28ClN3O and a molecular weight of 373.93 g/mol. Its IUPAC name is N-[[(3R)-1-(3-chlorophenyl)pyrrolidin-3-yl]methyl]-1-(furan-2-ylmethyl)piperidin-4-amine.
| Compound Name | N-[[(3R)-1-(3-chlorophenyl)pyrrolidin-3-yl]methyl]-1-(furan-2-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 171359941 |
| Molecular Formula | C21H28ClN3O |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-[[(3R)-1-(3-chlorophenyl)pyrrolidin-3-yl]methyl]-1-(furan-2-ylmethyl)piperidin-4-amine |
| SMILES | Clc1cccc(N2CC[C@H](CNC3CCN(Cc4ccco4)CC3)C2)c1 |
| InChI | InChI=1S/C21H28ClN3O/c22-18-3-1-4-20(13-18)25-11-6-17(15-25)14-23-19-7-9-24(10-8-19)16-21-5-2-12-26-21/h1-5,12-13,17,19,23H,6-11,14-16H2/t17-/m1/s1 |
| InChIKey | UTCNSYZXYNKSPF-QGZVFWFLSA-N |
| XLogP | 4.01 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |