C27H50O17P2 — CID 171362209
[(2R)-1-butanoyloxy-3-[[(2R)-3-[[(2R)-2-butanoyloxy-3-propanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] heptanoate (PubChem CID 171362209) has the molecular formula C27H50O17P2 and a molecular weight of 708.63 g/mol. Its IUPAC name is [(2R)-1-butanoyloxy-3-[[(2R)-3-[[(2R)-2-butanoyloxy-3-propanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] heptanoate.
| Compound Name | [(2R)-1-butanoyloxy-3-[[(2R)-3-[[(2R)-2-butanoyloxy-3-propanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] heptanoate |
|---|---|
| PubChem CID | 171362209 |
| Molecular Formula | C27H50O17P2 |
| Molecular Weight | 708.63 g/mol |
| Exact Mass | 708.25 |
| IUPAC Name | [(2R)-1-butanoyloxy-3-[[(2R)-3-[[(2R)-2-butanoyloxy-3-propanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropan-2-yl] heptanoate |
| SMILES | CCCCCCC(=O)O[C@H](COC(=O)CCC)COP(=O)(O)OC[C@H](O)COP(=O)(O)OC[C@@H](COC(=O)CC)OC(=O)CCC |
| InChI | InChI=1S/C27H50O17P2/c1-5-9-10-11-14-27(32)44-23(18-38-25(30)12-6-2)20-42-46(35,36)40-16-21(28)15-39-45(33,34)41-19-22(17-37-24(29)8-4)43-26(31)13-7-3/h21-23,28H,5-20H2,1-4H3,(H,33,34)(H,35,36)/t21-,22-,23-/m1/s1 |
| InChIKey | UPFZVUIYNHPPGB-DNVJHFABSA-N |
| XLogP | 3.51 |
| TPSA | 236.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.63 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|