C21H26ClN5 — CID 171362702
6-chloro-N-[[6-[(1-methylpiperidin-4-yl)methylamino]-3-pyridinyl]methyl]-1H-indol-4-amine (PubChem CID 171362702) has the molecular formula C21H26ClN5 and a molecular weight of 383.93 g/mol. Its IUPAC name is 6-chloro-N-[[6-[(1-methylpiperidin-4-yl)methylamino]-3-pyridinyl]methyl]-1H-indol-4-amine.
| Compound Name | 6-chloro-N-[[6-[(1-methylpiperidin-4-yl)methylamino]-3-pyridinyl]methyl]-1H-indol-4-amine |
|---|---|
| PubChem CID | 171362702 |
| Molecular Formula | C21H26ClN5 |
| Molecular Weight | 383.93 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 6-chloro-N-[[6-[(1-methylpiperidin-4-yl)methylamino]-3-pyridinyl]methyl]-1H-indol-4-amine |
| SMILES | CN1CCC(CNc2ccc(CNc3cc(Cl)cc4[nH]ccc34)cn2)CC1 |
| InChI | InChI=1S/C21H26ClN5/c1-27-8-5-15(6-9-27)12-25-21-3-2-16(14-26-21)13-24-20-11-17(22)10-19-18(20)4-7-23-19/h2-4,7,10-11,14-15,23-24H,5-6,8-9,12-13H2,1H3,(H,25,26) |
| InChIKey | KAWMSCNPZACOEC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |